C14H20BrN3O3 — CID 126667087
1-[(2S)-1-(4-bromo-5-methoxy-2-nitrophenyl)pyrrolidin-2-yl]-N,N-dimethylmethanamine (PubChem CID 126667087) has the molecular formula C14H20BrN3O3 and a molecular weight of 358.24 g/mol. Its IUPAC name is 1-[(2S)-1-(4-bromo-5-methoxy-2-nitrophenyl)pyrrolidin-2-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(2S)-1-(4-bromo-5-methoxy-2-nitrophenyl)pyrrolidin-2-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 126667087 |
| Molecular Formula | C14H20BrN3O3 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 1-[(2S)-1-(4-bromo-5-methoxy-2-nitrophenyl)pyrrolidin-2-yl]-N,N-dimethylmethanamine |
| SMILES | COc1cc(N2CCC[C@H]2CN(C)C)c([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C14H20BrN3O3/c1-16(2)9-10-5-4-6-17(10)12-8-14(21-3)11(15)7-13(12)18(19)20/h7-8,10H,4-6,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | FHCXXTMBIIGDFX-JTQLQIEISA-N |
| XLogP | 2.90 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|