C22H26ClN7O4S — CID 167455053
N-[2-[[2-(5-amino-2-methoxy-4-morpholin-4-ylanilino)-5-chloropyrimidin-4-yl]amino]phenyl]methanesulfonamide (PubChem CID 167455053) has the molecular formula C22H26ClN7O4S and a molecular weight of 520.02 g/mol. Its IUPAC name is N-[2-[[2-(5-amino-2-methoxy-4-morpholin-4-ylanilino)-5-chloropyrimidin-4-yl]amino]phenyl]methanesulfonamide.
| Compound Name | N-[2-[[2-(5-amino-2-methoxy-4-morpholin-4-ylanilino)-5-chloropyrimidin-4-yl]amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 167455053 |
| Molecular Formula | C22H26ClN7O4S |
| Molecular Weight | 520.02 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | N-[2-[[2-(5-amino-2-methoxy-4-morpholin-4-ylanilino)-5-chloropyrimidin-4-yl]amino]phenyl]methanesulfonamide |
| SMILES | COc1cc(N2CCOCC2)c(N)cc1Nc1ncc(Cl)c(Nc2ccccc2NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C22H26ClN7O4S/c1-33-20-12-19(30-7-9-34-10-8-30)15(24)11-18(20)27-22-25-13-14(23)21(28-22)26-16-5-3-4-6-17(16)29-35(2,31)32/h3-6,11-13,29H,7-10,24H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | ZOKDRCQALBIAIW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 143.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.02 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|