C26H32ClN7O4S — CID 164550586
N-[2-[[2-[[(4aS)-9-methoxy-3-propan-2-yl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-5-chloropyrimidin-4-yl]amino]phenyl]methanesulfonamide (PubChem CID 164550586) has the molecular formula C26H32ClN7O4S and a molecular weight of 574.11 g/mol. Its IUPAC name is N-[2-[[2-[[(4aS)-9-methoxy-3-propan-2-yl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-5-chloropyrimidin-4-yl]amino]phenyl]methanesulfonamide.
| Compound Name | N-[2-[[2-[[(4aS)-9-methoxy-3-propan-2-yl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-5-chloropyrimidin-4-yl]amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 164550586 |
| Molecular Formula | C26H32ClN7O4S |
| Molecular Weight | 574.11 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | N-[2-[[2-[[(4aS)-9-methoxy-3-propan-2-yl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-5-chloropyrimidin-4-yl]amino]phenyl]methanesulfonamide |
| SMILES | COc1cc2c(cc1Nc1ncc(Cl)c(Nc3ccccc3NS(C)(=O)=O)n1)OC[C@@H]1CN(C(C)C)CCN21 |
| InChI | InChI=1S/C26H32ClN7O4S/c1-16(2)33-9-10-34-17(14-33)15-38-24-11-21(23(37-3)12-22(24)34)30-26-28-13-18(27)25(31-26)29-19-7-5-6-8-20(19)32-39(4,35)36/h5-8,11-13,16-17,32H,9-10,14-15H2,1-4H3,(H2,28,29,30,31)/t17-/m0/s1 |
| InChIKey | ZKUSOQKVTABEAR-KRWDZBQOSA-N |
| XLogP | 4.29 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.11 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |