C29H33ClN7O3P — CID 164550608
2-N-[(4aR)-3-cyclopropyl-9-methoxy-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 164550608) has the molecular formula C29H33ClN7O3P and a molecular weight of 594.06 g/mol. Its IUPAC name is 2-N-[(4aR)-3-cyclopropyl-9-methoxy-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(4aR)-3-cyclopropyl-9-methoxy-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164550608 |
| Molecular Formula | C29H33ClN7O3P |
| Molecular Weight | 594.06 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | 2-N-[(4aR)-3-cyclopropyl-9-methoxy-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | COc1cc2c(cc1Nc1nc(Nc3ccccc3P(C)(C)=O)c3c(Cl)c[nH]c3n1)OC[C@H]1CN(C3CC3)CCN21 |
| InChI | InChI=1S/C29H33ClN7O3P/c1-39-23-13-22-24(40-16-18-15-36(17-8-9-17)10-11-37(18)22)12-21(23)33-29-34-27-26(19(30)14-31-27)28(35-29)32-20-6-4-5-7-25(20)41(2,3)38/h4-7,12-14,17-18H,8-11,15-16H2,1-3H3,(H3,31,32,33,34,35)/t18-/m1/s1 |
| InChIKey | LUTIVMKTHBDSIM-GOSISDBHSA-N |
| XLogP | 5.40 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.06 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|