C28H34ClN6O3P — CID 155140105
2-N-[(4aS)-3-(oxan-4-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 155140105) has the molecular formula C28H34ClN6O3P and a molecular weight of 569.05 g/mol. Its IUPAC name is 2-N-[(4aS)-3-(oxan-4-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(4aS)-3-(oxan-4-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155140105 |
| Molecular Formula | C28H34ClN6O3P |
| Molecular Weight | 569.05 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 2-N-[(4aS)-3-(oxan-4-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(Nc2ccc3c(c2)OC[C@@H]2CN(C4CCOCC4)CCN32)ncc1Cl |
| InChI | InChI=1S/C28H34ClN6O3P/c1-39(2,36)26-6-4-3-5-23(26)32-27-22(29)16-30-28(33-27)31-19-7-8-24-25(15-19)38-18-21-17-34(11-12-35(21)24)20-9-13-37-14-10-20/h3-8,15-16,20-21H,9-14,17-18H2,1-2H3,(H2,30,31,32,33)/t21-/m0/s1 |
| InChIKey | TVXWDEOTEJTTAJ-NRFANRHFSA-N |
| XLogP | 4.93 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.05 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|