C24H28ClN6O2P — CID 155139808
2-N-[(4aS)-10-methyl-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 155139808) has the molecular formula C24H28ClN6O2P and a molecular weight of 498.96 g/mol. Its IUPAC name is 2-N-[(4aS)-10-methyl-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(4aS)-10-methyl-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155139808 |
| Molecular Formula | C24H28ClN6O2P |
| Molecular Weight | 498.96 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 2-N-[(4aS)-10-methyl-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)cc2c1N1CCNC[C@H]1CO2 |
| InChI | InChI=1S/C24H28ClN6O2P/c1-15-10-16(11-20-22(15)31-9-8-26-12-17(31)14-33-20)28-24-27-13-18(25)23(30-24)29-19-6-4-5-7-21(19)34(2,3)32/h4-7,10-11,13,17,26H,8-9,12,14H2,1-3H3,(H2,27,28,29,30)/t17-/m0/s1 |
| InChIKey | VUVJJVDCCCNAGQ-KRWDZBQOSA-N |
| XLogP | 4.34 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.96 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|