C25H27ClF3N6O2P — CID 155140071
2-N-[(4aR)-3-(2,2,2-trifluoroethyl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 155140071) has the molecular formula C25H27ClF3N6O2P and a molecular weight of 566.95 g/mol. Its IUPAC name is 2-N-[(4aR)-3-(2,2,2-trifluoroethyl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(4aR)-3-(2,2,2-trifluoroethyl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155140071 |
| Molecular Formula | C25H27ClF3N6O2P |
| Molecular Weight | 566.95 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 2-N-[(4aR)-3-(2,2,2-trifluoroethyl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(Nc2ccc3c(c2)OC[C@H]2CN(CC(F)(F)F)CCN32)ncc1Cl |
| InChI | InChI=1S/C25H27ClF3N6O2P/c1-38(2,36)22-6-4-3-5-19(22)32-23-18(26)12-30-24(33-23)31-16-7-8-20-21(11-16)37-14-17-13-34(9-10-35(17)20)15-25(27,28)29/h3-8,11-12,17H,9-10,13-15H2,1-2H3,(H2,30,31,32,33)/t17-/m1/s1 |
| InChIKey | DWOFNRRKPRGVGY-QGZVFWFLSA-N |
| XLogP | 5.31 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.95 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|