C27H35ClN7O2P — CID 164771543
2-N-[(4aS)-3-[2-(dimethylamino)ethyl]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 164771543) has the molecular formula C27H35ClN7O2P and a molecular weight of 556.05 g/mol. Its IUPAC name is 2-N-[(4aS)-3-[2-(dimethylamino)ethyl]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(4aS)-3-[2-(dimethylamino)ethyl]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164771543 |
| Molecular Formula | C27H35ClN7O2P |
| Molecular Weight | 556.05 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 2-N-[(4aS)-3-[2-(dimethylamino)ethyl]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | CN(C)CCN1CCN2c3ccc(Nc4ncc(Cl)c(Nc5ccccc5P(C)(C)=O)n4)cc3OC[C@@H]2C1 |
| InChI | InChI=1S/C27H35ClN7O2P/c1-33(2)11-12-34-13-14-35-20(17-34)18-37-24-15-19(9-10-23(24)35)30-27-29-16-21(28)26(32-27)31-22-7-5-6-8-25(22)38(3,4)36/h5-10,15-16,20H,11-14,17-18H2,1-4H3,(H2,29,30,31,32)/t20-/m0/s1 |
| InChIKey | KRQRHDWGXDRAPI-FQEVSTJZSA-N |
| XLogP | 4.31 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.05 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|