C17H22ClN4OP — CID 71006827
5-chloro-2-N-cyclopentyl-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 71006827) has the molecular formula C17H22ClN4OP and a molecular weight of 364.82 g/mol. Its IUPAC name is 5-chloro-2-N-cyclopentyl-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-cyclopentyl-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71006827 |
| Molecular Formula | C17H22ClN4OP |
| Molecular Weight | 364.82 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 5-chloro-2-N-cyclopentyl-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(NC2CCCC2)ncc1Cl |
| InChI | InChI=1S/C17H22ClN4OP/c1-24(2,23)15-10-6-5-9-14(15)21-16-13(18)11-19-17(22-16)20-12-7-3-4-8-12/h5-6,9-12H,3-4,7-8H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | DTVKBQNUHBGQEK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|