C24H26ClN6O4P — CID 118147719
5-chloro-2-N-[4-[3-(dimethylamino)prop-1-ynyl]-2-methoxy-5-nitrophenyl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 118147719) has the molecular formula C24H26ClN6O4P and a molecular weight of 528.94 g/mol. Its IUPAC name is 5-chloro-2-N-[4-[3-(dimethylamino)prop-1-ynyl]-2-methoxy-5-nitrophenyl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[4-[3-(dimethylamino)prop-1-ynyl]-2-methoxy-5-nitrophenyl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118147719 |
| Molecular Formula | C24H26ClN6O4P |
| Molecular Weight | 528.94 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 5-chloro-2-N-[4-[3-(dimethylamino)prop-1-ynyl]-2-methoxy-5-nitrophenyl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(C#CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc(Cl)c(Nc2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C24H26ClN6O4P/c1-30(2)12-8-9-16-13-21(35-3)19(14-20(16)31(32)33)28-24-26-15-17(25)23(29-24)27-18-10-6-7-11-22(18)36(4,5)34/h6-7,10-11,13-15H,12H2,1-5H3,(H2,26,27,28,29) |
| InChIKey | SRRNOMWMKSWFKF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.94 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|