C29H34ClN6O4P — CID 118129145
N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[3-[2-methoxyethyl(methyl)amino]prop-1-ynyl]phenyl]prop-2-enamide (PubChem CID 118129145) has the molecular formula C29H34ClN6O4P and a molecular weight of 597.06 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[3-[2-methoxyethyl(methyl)amino]prop-1-ynyl]phenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[3-[2-methoxyethyl(methyl)amino]prop-1-ynyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118129145 |
| Molecular Formula | C29H34ClN6O4P |
| Molecular Weight | 597.06 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[3-[2-methoxyethyl(methyl)amino]prop-1-ynyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c(OC)cc1C#CCN(C)CCOC |
| InChI | InChI=1S/C29H34ClN6O4P/c1-7-27(37)32-23-18-24(25(40-4)17-20(23)11-10-14-36(2)15-16-39-3)34-29-31-19-21(30)28(35-29)33-22-12-8-9-13-26(22)41(5,6)38/h7-9,12-13,17-19H,1,14-16H2,2-6H3,(H,32,37)(H2,31,33,34,35) |
| InChIKey | RGRDRNWYFNVWMM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.06 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|