C27H29ClN6O2 — CID 146246779
N-[5-[[5-chloro-4-(2-propan-2-ylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[3-(methylamino)prop-1-ynyl]phenyl]prop-2-enamide (PubChem CID 146246779) has the molecular formula C27H29ClN6O2 and a molecular weight of 505.02 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(2-propan-2-ylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[3-(methylamino)prop-1-ynyl]phenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-(2-propan-2-ylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[3-(methylamino)prop-1-ynyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146246779 |
| Molecular Formula | C27H29ClN6O2 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | N-[5-[[5-chloro-4-(2-propan-2-ylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[3-(methylamino)prop-1-ynyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccccc3C(C)C)n2)c(OC)cc1C#CCNC |
| InChI | InChI=1S/C27H29ClN6O2/c1-6-25(35)31-22-15-23(24(36-5)14-18(22)10-9-13-29-4)33-27-30-16-20(28)26(34-27)32-21-12-8-7-11-19(21)17(2)3/h6-8,11-12,14-17,29H,1,13H2,2-5H3,(H,31,35)(H2,30,32,33,34) |
| InChIKey | NKXMDEGOYLHGIL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|