C23H24ClF2N7O2 — CID 129281740
N-[5-[[5-chloro-4-(2,6-difluoroanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[2-(methylamino)ethylamino]phenyl]prop-2-enamide (PubChem CID 129281740) has the molecular formula C23H24ClF2N7O2 and a molecular weight of 503.94 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(2,6-difluoroanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[2-(methylamino)ethylamino]phenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-(2,6-difluoroanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[2-(methylamino)ethylamino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 129281740 |
| Molecular Formula | C23H24ClF2N7O2 |
| Molecular Weight | 503.94 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | N-[5-[[5-chloro-4-(2,6-difluoroanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[2-(methylamino)ethylamino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3c(F)cccc3F)n2)c(OC)cc1NCCNC |
| InChI | InChI=1S/C23H24ClF2N7O2/c1-4-20(34)30-17-10-18(19(35-3)11-16(17)28-9-8-27-2)31-23-29-12-13(24)22(33-23)32-21-14(25)6-5-7-15(21)26/h4-7,10-12,27-28H,1,8-9H2,2-3H3,(H,30,34)(H2,29,31,32,33) |
| InChIKey | NHWUJGKVYNMJQT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.94 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|