C27H34ClN6O5P — CID 118147709
N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[2-[methoxymethyl(methyl)amino]ethoxy]phenyl]prop-2-enamide (PubChem CID 118147709) has the molecular formula C27H34ClN6O5P and a molecular weight of 589.03 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[2-[methoxymethyl(methyl)amino]ethoxy]phenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[2-[methoxymethyl(methyl)amino]ethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118147709 |
| Molecular Formula | C27H34ClN6O5P |
| Molecular Weight | 589.03 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxy-2-[2-[methoxymethyl(methyl)amino]ethoxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c(OC)cc1OCCN(C)COC |
| InChI | InChI=1S/C27H34ClN6O5P/c1-7-25(35)30-21-14-20(22(38-4)15-23(21)39-13-12-34(2)17-37-3)32-27-29-16-18(28)26(33-27)31-19-10-8-9-11-24(19)40(5,6)36/h7-11,14-16H,1,12-13,17H2,2-6H3,(H,30,35)(H2,29,31,32,33) |
| InChIKey | QBZZBDBJSSGWGT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.03 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|