C27H33ClN5O4P — CID 159231568
N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]methyl]-2-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide (PubChem CID 159231568) has the molecular formula C27H33ClN5O4P and a molecular weight of 558.02 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]methyl]-2-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]methyl]-2-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 159231568 |
| Molecular Formula | C27H33ClN5O4P |
| Molecular Weight | 558.02 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | N-[5-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]methyl]-2-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Cc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c(OC)cc1OCCN(C)C |
| InChI | InChI=1S/C27H33ClN5O4P/c1-7-26(34)30-21-14-18(22(36-4)16-23(21)37-13-12-33(2)3)15-25-29-17-19(28)27(32-25)31-20-10-8-9-11-24(20)38(5,6)35/h7-11,14,16-17H,1,12-13,15H2,2-6H3,(H,30,34)(H,29,31,32) |
| InChIKey | GQQRSDGFEUFGKD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.02 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|