C23H28ClN7O4 — CID 175226350
[3-[[2-[5-amino-4-(diethylamino)-2-methoxyanilino]-5-chloropyrimidin-4-yl]amino]-4-methoxyphenyl] carbamate (PubChem CID 175226350) has the molecular formula C23H28ClN7O4 and a molecular weight of 501.98 g/mol. Its IUPAC name is [3-[[2-[5-amino-4-(diethylamino)-2-methoxyanilino]-5-chloropyrimidin-4-yl]amino]-4-methoxyphenyl] carbamate.
| Compound Name | [3-[[2-[5-amino-4-(diethylamino)-2-methoxyanilino]-5-chloropyrimidin-4-yl]amino]-4-methoxyphenyl] carbamate |
|---|---|
| PubChem CID | 175226350 |
| Molecular Formula | C23H28ClN7O4 |
| Molecular Weight | 501.98 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | [3-[[2-[5-amino-4-(diethylamino)-2-methoxyanilino]-5-chloropyrimidin-4-yl]amino]-4-methoxyphenyl] carbamate |
| SMILES | CCN(CC)c1cc(OC)c(Nc2ncc(Cl)c(Nc3cc(OC(N)=O)ccc3OC)n2)cc1N |
| InChI | InChI=1S/C23H28ClN7O4/c1-5-31(6-2)18-11-20(34-4)17(10-15(18)25)29-23-27-12-14(24)21(30-23)28-16-9-13(35-22(26)32)7-8-19(16)33-3/h7-12H,5-6,25H2,1-4H3,(H2,26,32)(H2,27,28,29,30) |
| InChIKey | AYDIQDDXMSHKCY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.98 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|