C23H26ClN8O2P — CID 155183896
4-N-[5-chloro-4-[(5-dimethylphosphorylquinoxalin-6-yl)amino]pyrimidin-2-yl]-1-N-ethyl-5-methoxybenzene-1,2,4-triamine (PubChem CID 155183896) has the molecular formula C23H26ClN8O2P and a molecular weight of 512.94 g/mol. Its IUPAC name is 4-N-[5-chloro-4-[(5-dimethylphosphorylquinoxalin-6-yl)amino]pyrimidin-2-yl]-1-N-ethyl-5-methoxybenzene-1,2,4-triamine.
| Compound Name | 4-N-[5-chloro-4-[(5-dimethylphosphorylquinoxalin-6-yl)amino]pyrimidin-2-yl]-1-N-ethyl-5-methoxybenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 155183896 |
| Molecular Formula | C23H26ClN8O2P |
| Molecular Weight | 512.94 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 4-N-[5-chloro-4-[(5-dimethylphosphorylquinoxalin-6-yl)amino]pyrimidin-2-yl]-1-N-ethyl-5-methoxybenzene-1,2,4-triamine |
| SMILES | CCNc1cc(OC)c(Nc2ncc(Cl)c(Nc3ccc4nccnc4c3P(C)(C)=O)n2)cc1N |
| InChI | InChI=1S/C23H26ClN8O2P/c1-5-26-17-11-19(34-2)18(10-14(17)25)31-23-29-12-13(24)22(32-23)30-16-7-6-15-20(28-9-8-27-15)21(16)35(3,4)33/h6-12,26H,5,25H2,1-4H3,(H2,29,30,31,32) |
| InChIKey | MXRQCIVFQYUTAN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 139.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.94 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|