C22H24N8O5 — CID 121269200
1-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxy-5-nitroanilino]-5-methylpyrimidin-4-yl]pyrazole-4-carbaldehyde (PubChem CID 121269200) has the molecular formula C22H24N8O5 and a molecular weight of 480.49 g/mol. Its IUPAC name is 1-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxy-5-nitroanilino]-5-methylpyrimidin-4-yl]pyrazole-4-carbaldehyde.
| Compound Name | 1-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxy-5-nitroanilino]-5-methylpyrimidin-4-yl]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 121269200 |
| Molecular Formula | C22H24N8O5 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 1-[2-[4-(4-acetylpiperazin-1-yl)-2-methoxy-5-nitroanilino]-5-methylpyrimidin-4-yl]pyrazole-4-carbaldehyde |
| SMILES | COc1cc(N2CCN(C(C)=O)CC2)c([N+](=O)[O-])cc1Nc1ncc(C)c(-n2cc(C=O)cn2)n1 |
| InChI | InChI=1S/C22H24N8O5/c1-14-10-23-22(26-21(14)29-12-16(13-31)11-24-29)25-17-8-19(30(33)34)18(9-20(17)35-3)28-6-4-27(5-7-28)15(2)32/h8-13H,4-7H2,1-3H3,(H,23,25,26) |
| InChIKey | UOALSLQLKZGJQP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|