C18H17FN6O4 — CID 121268984
1-[2-(4-fluoro-5-nitro-2-propan-2-yloxyanilino)-5-methylpyrimidin-4-yl]pyrazole-4-carbaldehyde (PubChem CID 121268984) has the molecular formula C18H17FN6O4 and a molecular weight of 400.37 g/mol. Its IUPAC name is 1-[2-(4-fluoro-5-nitro-2-propan-2-yloxyanilino)-5-methylpyrimidin-4-yl]pyrazole-4-carbaldehyde.
| Compound Name | 1-[2-(4-fluoro-5-nitro-2-propan-2-yloxyanilino)-5-methylpyrimidin-4-yl]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 121268984 |
| Molecular Formula | C18H17FN6O4 |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-[2-(4-fluoro-5-nitro-2-propan-2-yloxyanilino)-5-methylpyrimidin-4-yl]pyrazole-4-carbaldehyde |
| SMILES | Cc1cnc(Nc2cc([N+](=O)[O-])c(F)cc2OC(C)C)nc1-n1cc(C=O)cn1 |
| InChI | InChI=1S/C18H17FN6O4/c1-10(2)29-16-4-13(19)15(25(27)28)5-14(16)22-18-20-6-11(3)17(23-18)24-8-12(9-26)7-21-24/h4-10H,1-3H3,(H,20,22,23) |
| InChIKey | JAEPOCDMCGSXLD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|