C23H25N7O6S — CID 162643440
methyl 3-[[2-[[1-[2-(dimethylamino)acetyl]-5-methoxy-2,3-dihydroindol-6-yl]amino]-5-nitropyrimidin-4-yl]amino]thiophene-2-carboxylate (PubChem CID 162643440) has the molecular formula C23H25N7O6S and a molecular weight of 527.56 g/mol. Its IUPAC name is methyl 3-[[2-[[1-[2-(dimethylamino)acetyl]-5-methoxy-2,3-dihydroindol-6-yl]amino]-5-nitropyrimidin-4-yl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-[[1-[2-(dimethylamino)acetyl]-5-methoxy-2,3-dihydroindol-6-yl]amino]-5-nitropyrimidin-4-yl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 162643440 |
| Molecular Formula | C23H25N7O6S |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | methyl 3-[[2-[[1-[2-(dimethylamino)acetyl]-5-methoxy-2,3-dihydroindol-6-yl]amino]-5-nitropyrimidin-4-yl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1Nc1nc(Nc2cc3c(cc2OC)CCN3C(=O)CN(C)C)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H25N7O6S/c1-28(2)12-19(31)29-7-5-13-9-18(35-3)15(10-16(13)29)26-23-24-11-17(30(33)34)21(27-23)25-14-6-8-37-20(14)22(32)36-4/h6,8-11H,5,7,12H2,1-4H3,(H2,24,25,26,27) |
| InChIKey | UVPBFWMHQUSPOD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|