C20H29N7O3S — CID 90431691
N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-2,5-dimethyl-1,1-dioxo-3,4-dihydropyrimido[4,5-f][1,2,5]thiadiazepin-7-amine (PubChem CID 90431691) has the molecular formula C20H29N7O3S and a molecular weight of 447.57 g/mol. Its IUPAC name is N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-2,5-dimethyl-1,1-dioxo-3,4-dihydropyrimido[4,5-f][1,2,5]thiadiazepin-7-amine.
| Compound Name | N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-2,5-dimethyl-1,1-dioxo-3,4-dihydropyrimido[4,5-f][1,2,5]thiadiazepin-7-amine |
|---|---|
| PubChem CID | 90431691 |
| Molecular Formula | C20H29N7O3S |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-2,5-dimethyl-1,1-dioxo-3,4-dihydropyrimido[4,5-f][1,2,5]thiadiazepin-7-amine |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1Nc1ncc2c(n1)N(C)CCN(C)S2(=O)=O |
| InChI | InChI=1S/C20H29N7O3S/c1-24-7-11-27(12-8-24)15-5-6-16(17(13-15)30-4)22-20-21-14-18-19(23-20)25(2)9-10-26(3)31(18,28)29/h5-6,13-14H,7-12H2,1-4H3,(H,21,22,23) |
| InChIKey | VUPVJGDWSDJQTI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |