C23H25N7O — CID 168990717
N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-7-(1H-pyrazol-4-yl)quinazolin-2-amine (PubChem CID 168990717) has the molecular formula C23H25N7O and a molecular weight of 415.50 g/mol. Its IUPAC name is N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-7-(1H-pyrazol-4-yl)quinazolin-2-amine.
| Compound Name | N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-7-(1H-pyrazol-4-yl)quinazolin-2-amine |
|---|---|
| PubChem CID | 168990717 |
| Molecular Formula | C23H25N7O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-7-(1H-pyrazol-4-yl)quinazolin-2-amine |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1Nc1ncc2ccc(-c3cn[nH]c3)cc2n1 |
| InChI | InChI=1S/C23H25N7O/c1-29-7-9-30(10-8-29)19-5-6-20(22(12-19)31-2)27-23-24-13-17-4-3-16(11-21(17)28-23)18-14-25-26-15-18/h3-6,11-15H,7-10H2,1-2H3,(H,25,26)(H,24,27,28) |
| InChIKey | LLVXFSYZVPRBFF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |