C18H21N7 — CID 141081126
N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1H-pyrazol-4-yl)pyrimidin-2-amine (PubChem CID 141081126) has the molecular formula C18H21N7 and a molecular weight of 335.42 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1H-pyrazol-4-yl)pyrimidin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1H-pyrazol-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 141081126 |
| Molecular Formula | C18H21N7 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(1H-pyrazol-4-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3nccc(-c4cn[nH]c4)n3)cc2)CC1 |
| InChI | InChI=1S/C18H21N7/c1-24-8-10-25(11-9-24)16-4-2-15(3-5-16)22-18-19-7-6-17(23-18)14-12-20-21-13-14/h2-7,12-13H,8-11H2,1H3,(H,20,21)(H,19,22,23) |
| InChIKey | OYCWMAWOWCTDRU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|