C28H27N7O2S — CID 164606257
3-(4-methoxyphenyl)-2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 164606257) has the molecular formula C28H27N7O2S and a molecular weight of 525.64 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 3-(4-methoxyphenyl)-2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 164606257 |
| Molecular Formula | C28H27N7O2S |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | COc1ccc(-c2c(-c3ccnc(Nc4ccc(N5CCN(C)CC5)cc4)n3)sc3nccc(=O)n23)cc1 |
| InChI | InChI=1S/C28H27N7O2S/c1-33-15-17-34(18-16-33)21-7-5-20(6-8-21)31-27-29-13-11-23(32-27)26-25(19-3-9-22(37-2)10-4-19)35-24(36)12-14-30-28(35)38-26/h3-14H,15-18H2,1-2H3,(H,29,31,32) |
| InChIKey | QLMDQNDKRRSSAJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|