C25H30N6O4 — CID 69072634
(2,5-dimethoxyphenyl)methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamic acid (PubChem CID 69072634) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamic acid.
| Compound Name | (2,5-dimethoxyphenyl)methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69072634 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamic acid |
| SMILES | COc1ccc(OC)c(CN(C(=O)O)c2ccnc(Nc3ccc(N4CCN(C)CC4)cc3)n2)c1 |
| InChI | InChI=1S/C25H30N6O4/c1-29-12-14-30(15-13-29)20-6-4-19(5-7-20)27-24-26-11-10-23(28-24)31(25(32)33)17-18-16-21(34-2)8-9-22(18)35-3/h4-11,16H,12-15,17H2,1-3H3,(H,32,33)(H,26,27,28) |
| InChIKey | ZROBYRJDQOVWOV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|