C27H33ClN6O4 — CID 69065844
[2-[3-chloro-4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]-[(2,5-dimethoxyphenyl)methyl]carbamic acid (PubChem CID 69065844) has the molecular formula C27H33ClN6O4 and a molecular weight of 541.05 g/mol. Its IUPAC name is [2-[3-chloro-4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]-[(2,5-dimethoxyphenyl)methyl]carbamic acid.
| Compound Name | [2-[3-chloro-4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]-[(2,5-dimethoxyphenyl)methyl]carbamic acid |
|---|---|
| PubChem CID | 69065844 |
| Molecular Formula | C27H33ClN6O4 |
| Molecular Weight | 541.05 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | [2-[3-chloro-4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]-[(2,5-dimethoxyphenyl)methyl]carbamic acid |
| SMILES | COc1ccc(OC)c(CN(C(=O)O)c2ccnc(Nc3ccc(N4CCN(C(C)C)CC4)c(Cl)c3)n2)c1 |
| InChI | InChI=1S/C27H33ClN6O4/c1-18(2)32-11-13-33(14-12-32)23-7-5-20(16-22(23)28)30-26-29-10-9-25(31-26)34(27(35)36)17-19-15-21(37-3)6-8-24(19)38-4/h5-10,15-16,18H,11-14,17H2,1-4H3,(H,35,36)(H,29,30,31) |
| InChIKey | QSVKGNDZFMHMHL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.05 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|