C26H29ClF2N6O3 — CID 69062605
(5-chloro-2-fluorophenyl)methyl-[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamic acid (PubChem CID 69062605) has the molecular formula C26H29ClF2N6O3 and a molecular weight of 547.01 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)methyl-[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamic acid.
| Compound Name | (5-chloro-2-fluorophenyl)methyl-[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69062605 |
| Molecular Formula | C26H29ClF2N6O3 |
| Molecular Weight | 547.01 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | (5-chloro-2-fluorophenyl)methyl-[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamic acid |
| SMILES | CN1CCN(CCCOc2ccc(Nc3nccc(N(Cc4cc(Cl)ccc4F)C(=O)O)n3)cc2F)CC1 |
| InChI | InChI=1S/C26H29ClF2N6O3/c1-33-10-12-34(13-11-33)9-2-14-38-23-6-4-20(16-22(23)29)31-25-30-8-7-24(32-25)35(26(36)37)17-18-15-19(27)3-5-21(18)28/h3-8,15-16H,2,9-14,17H2,1H3,(H,36,37)(H,30,31,32) |
| InChIKey | QIRNTQASISILLQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.01 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|