C26H28Cl2FN5O3 — CID 154456180
(2,5-dichlorophenyl) N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]-N-methylcarbamate (PubChem CID 154456180) has the molecular formula C26H28Cl2FN5O3 and a molecular weight of 548.45 g/mol. Its IUPAC name is (2,5-dichlorophenyl) N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]-N-methylcarbamate.
| Compound Name | (2,5-dichlorophenyl) N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 154456180 |
| Molecular Formula | C26H28Cl2FN5O3 |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | (2,5-dichlorophenyl) N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)Oc1cc(Cl)ccc1Cl)c1ccnc(Nc2ccc(OCCCN3CCCCC3)c(F)c2)n1 |
| InChI | InChI=1S/C26H28Cl2FN5O3/c1-33(26(35)37-23-16-18(27)6-8-20(23)28)24-10-11-30-25(32-24)31-19-7-9-22(21(29)17-19)36-15-5-14-34-12-3-2-4-13-34/h6-11,16-17H,2-5,12-15H2,1H3,(H,30,31,32) |
| InChIKey | TUOLHJCLSZFYAK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|