C26H29Cl2N5O3 — CID 154456286
(3,5-dichlorophenyl) N-methyl-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate (PubChem CID 154456286) has the molecular formula C26H29Cl2N5O3 and a molecular weight of 530.46 g/mol. Its IUPAC name is (3,5-dichlorophenyl) N-methyl-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate.
| Compound Name | (3,5-dichlorophenyl) N-methyl-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 154456286 |
| Molecular Formula | C26H29Cl2N5O3 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | (3,5-dichlorophenyl) N-methyl-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate |
| SMILES | CN(C(=O)Oc1cc(Cl)cc(Cl)c1)c1ccnc(Nc2cccc(OCCCN3CCCCC3)c2)n1 |
| InChI | InChI=1S/C26H29Cl2N5O3/c1-32(26(34)36-23-16-19(27)15-20(28)17-23)24-9-10-29-25(31-24)30-21-7-5-8-22(18-21)35-14-6-13-33-11-3-2-4-12-33/h5,7-10,15-18H,2-4,6,11-14H2,1H3,(H,29,30,31) |
| InChIKey | HVDPGHJBYNBCMK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|