C27H33N5O4 — CID 154456331
(2-methoxy-4-methylphenyl)-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid (PubChem CID 154456331) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is (2-methoxy-4-methylphenyl)-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid.
| Compound Name | (2-methoxy-4-methylphenyl)-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 154456331 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | (2-methoxy-4-methylphenyl)-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid |
| SMILES | COc1cc(C)ccc1N(C(=O)O)c1ccnc(Nc2cccc(OCCCN3CCCCC3)c2)n1 |
| InChI | InChI=1S/C27H33N5O4/c1-20-10-11-23(24(18-20)35-2)32(27(33)34)25-12-13-28-26(30-25)29-21-8-6-9-22(19-21)36-17-7-16-31-14-4-3-5-15-31/h6,8-13,18-19H,3-5,7,14-17H2,1-2H3,(H,33,34)(H,28,29,30) |
| InChIKey | HRDAVYJDZPDFDW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|