C35H41N5O5 — CID 69066797
(2,6-dimethylphenyl) N-(2,5-dimethoxyphenyl)-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate (PubChem CID 69066797) has the molecular formula C35H41N5O5 and a molecular weight of 611.74 g/mol. Its IUPAC name is (2,6-dimethylphenyl) N-(2,5-dimethoxyphenyl)-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate.
| Compound Name | (2,6-dimethylphenyl) N-(2,5-dimethoxyphenyl)-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 69066797 |
| Molecular Formula | C35H41N5O5 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | (2,6-dimethylphenyl) N-(2,5-dimethoxyphenyl)-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate |
| SMILES | COc1ccc(OC)c(N(C(=O)Oc2c(C)cccc2C)c2ccnc(Nc3cccc(OCCCN4CCCCC4)c3)n2)c1 |
| InChI | InChI=1S/C35H41N5O5/c1-25-11-8-12-26(2)33(25)45-35(41)40(30-24-28(42-3)15-16-31(30)43-4)32-17-18-36-34(38-32)37-27-13-9-14-29(23-27)44-22-10-21-39-19-6-5-7-20-39/h8-9,11-18,23-24H,5-7,10,19-22H2,1-4H3,(H,36,37,38) |
| InChIKey | SBIWFNINLRFNOZ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|