C36H43N5O7 — CID 69204397
[(2,5-dimethoxyphenyl)-(2,6-dimethoxyphenyl)methyl]-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid (PubChem CID 69204397) has the molecular formula C36H43N5O7 and a molecular weight of 657.77 g/mol. Its IUPAC name is [(2,5-dimethoxyphenyl)-(2,6-dimethoxyphenyl)methyl]-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid.
| Compound Name | [(2,5-dimethoxyphenyl)-(2,6-dimethoxyphenyl)methyl]-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69204397 |
| Molecular Formula | C36H43N5O7 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.32 |
| IUPAC Name | [(2,5-dimethoxyphenyl)-(2,6-dimethoxyphenyl)methyl]-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid |
| SMILES | COc1ccc(OC)c(C(c2c(OC)cccc2OC)N(C(=O)O)c2ccnc(Nc3cccc(OCCCN4CCCCC4)c3)n2)c1 |
| InChI | InChI=1S/C36H43N5O7/c1-44-26-15-16-29(45-2)28(24-26)34(33-30(46-3)13-9-14-31(33)47-4)41(36(42)43)32-17-18-37-35(39-32)38-25-11-8-12-27(23-25)48-22-10-21-40-19-6-5-7-20-40/h8-9,11-18,23-24,34H,5-7,10,19-22H2,1-4H3,(H,42,43)(H,37,38,39) |
| InChIKey | IAFCBXCCGMBFFJ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|