C35H40FN5O4 — CID 91373170
(3-methoxyphenyl)methyl N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]-N-[(1S)-1-phenylethyl]carbamate (PubChem CID 91373170) has the molecular formula C35H40FN5O4 and a molecular weight of 613.73 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]-N-[(1S)-1-phenylethyl]carbamate.
| Compound Name | (3-methoxyphenyl)methyl N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]-N-[(1S)-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 91373170 |
| Molecular Formula | C35H40FN5O4 |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 613.31 |
| IUPAC Name | (3-methoxyphenyl)methyl N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]-N-[(1S)-1-phenylethyl]carbamate |
| SMILES | COc1cccc(COC(=O)N(c2ccnc(Nc3ccc(OCCCN4CCCCC4)c(F)c3)n2)[C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C35H40FN5O4/c1-26(28-12-5-3-6-13-28)41(35(42)45-25-27-11-9-14-30(23-27)43-2)33-17-18-37-34(39-33)38-29-15-16-32(31(36)24-29)44-22-10-21-40-19-7-4-8-20-40/h3,5-6,9,11-18,23-24,26H,4,7-8,10,19-22,25H2,1-2H3,(H,37,38,39)/t26-/m0/s1 |
| InChIKey | PMIZGOWPMHHTFD-SANMLTNESA-N |
| XLogP | 7.53 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|