C35H40FN5O7 — CID 69060967
(2,6-dimethoxyphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate (PubChem CID 69060967) has the molecular formula C35H40FN5O7 and a molecular weight of 661.73 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate.
| Compound Name | (2,6-dimethoxyphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 69060967 |
| Molecular Formula | C35H40FN5O7 |
| Molecular Weight | 661.73 g/mol |
| Exact Mass | 661.29 |
| IUPAC Name | (2,6-dimethoxyphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate |
| SMILES | COc1ccc(N(C(=O)Oc2c(OC)cccc2OC)c2ccnc(Nc3ccc(OCCCN4CCCCC4)c(F)c3)n2)c(OC)c1 |
| InChI | InChI=1S/C35H40FN5O7/c1-43-25-13-14-27(31(23-25)46-4)41(35(42)48-33-29(44-2)10-8-11-30(33)45-3)32-16-17-37-34(39-32)38-24-12-15-28(26(36)22-24)47-21-9-20-40-18-6-5-7-19-40/h8,10-17,22-23H,5-7,9,18-21H2,1-4H3,(H,37,38,39) |
| InChIKey | ZBTGFBNKKWQZPA-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.73 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|