C35H40FN5O5 — CID 91075162
[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl] N-(2,5-dimethoxyphenyl)-N-(2,6-dimethylphenyl)carbamate (PubChem CID 91075162) has the molecular formula C35H40FN5O5 and a molecular weight of 629.73 g/mol. Its IUPAC name is [2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl] N-(2,5-dimethoxyphenyl)-N-(2,6-dimethylphenyl)carbamate.
| Compound Name | [2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl] N-(2,5-dimethoxyphenyl)-N-(2,6-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 91075162 |
| Molecular Formula | C35H40FN5O5 |
| Molecular Weight | 629.73 g/mol |
| Exact Mass | 629.30 |
| IUPAC Name | [2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl] N-(2,5-dimethoxyphenyl)-N-(2,6-dimethylphenyl)carbamate |
| SMILES | COc1ccc(OC)c(N(C(=O)Oc2ccnc(Nc3ccc(OCCCN4CCCCC4)c(F)c3)n2)c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C35H40FN5O5/c1-24-10-8-11-25(2)33(24)41(29-23-27(43-3)13-15-31(29)44-4)35(42)46-32-16-17-37-34(39-32)38-26-12-14-30(28(36)22-26)45-21-9-20-40-18-6-5-7-19-40/h8,10-17,22-23H,5-7,9,18-21H2,1-4H3,(H,37,38,39) |
| InChIKey | HUDSVDNRQJNIPS-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.73 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|