C33H43FN6O3 — CID 91037579
[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl] N-cyclohexyl-N-(2,6-dimethylphenyl)carbamate (PubChem CID 91037579) has the molecular formula C33H43FN6O3 and a molecular weight of 590.74 g/mol. Its IUPAC name is [2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl] N-cyclohexyl-N-(2,6-dimethylphenyl)carbamate.
| Compound Name | [2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl] N-cyclohexyl-N-(2,6-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 91037579 |
| Molecular Formula | C33H43FN6O3 |
| Molecular Weight | 590.74 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | [2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl] N-cyclohexyl-N-(2,6-dimethylphenyl)carbamate |
| SMILES | Cc1cccc(C)c1N(C(=O)Oc1ccnc(Nc2ccc(OCCCN3CCN(C)CC3)c(F)c2)n1)C1CCCCC1 |
| InChI | InChI=1S/C33H43FN6O3/c1-24-9-7-10-25(2)31(24)40(27-11-5-4-6-12-27)33(41)43-30-15-16-35-32(37-30)36-26-13-14-29(28(34)23-26)42-22-8-17-39-20-18-38(3)19-21-39/h7,9-10,13-16,23,27H,4-6,8,11-12,17-22H2,1-3H3,(H,35,36,37) |
| InChIKey | JNOPXESAVNRISX-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|