C37H39FN6O3 — CID 91470608
[6-(2,3-dimethylphenyl)naphthalen-2-yl] N-[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamate (PubChem CID 91470608) has the molecular formula C37H39FN6O3 and a molecular weight of 634.76 g/mol. Its IUPAC name is [6-(2,3-dimethylphenyl)naphthalen-2-yl] N-[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamate.
| Compound Name | [6-(2,3-dimethylphenyl)naphthalen-2-yl] N-[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 91470608 |
| Molecular Formula | C37H39FN6O3 |
| Molecular Weight | 634.76 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | [6-(2,3-dimethylphenyl)naphthalen-2-yl] N-[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamate |
| SMILES | Cc1cccc(-c2ccc3cc(OC(=O)Nc4ccnc(Nc5ccc(OCCCN6CCN(C)CC6)c(F)c5)n4)ccc3c2)c1C |
| InChI | InChI=1S/C37H39FN6O3/c1-25-6-4-7-32(26(25)2)29-9-8-28-23-31(12-10-27(28)22-29)47-37(45)42-35-14-15-39-36(41-35)40-30-11-13-34(33(38)24-30)46-21-5-16-44-19-17-43(3)18-20-44/h4,6-15,22-24H,5,16-21H2,1-3H3,(H2,39,40,41,42,45) |
| InChIKey | KSCLOVJRQRMCBE-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.76 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|