C37H40N6O3 — CID 11354034
naphthalen-2-yl N-(2,6-dimethylphenyl)-N-[2-[3-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamate (PubChem CID 11354034) has the molecular formula C37H40N6O3 and a molecular weight of 616.77 g/mol. Its IUPAC name is naphthalen-2-yl N-(2,6-dimethylphenyl)-N-[2-[3-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamate.
| Compound Name | naphthalen-2-yl N-(2,6-dimethylphenyl)-N-[2-[3-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 11354034 |
| Molecular Formula | C37H40N6O3 |
| Molecular Weight | 616.77 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | naphthalen-2-yl N-(2,6-dimethylphenyl)-N-[2-[3-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamate |
| SMILES | Cc1cccc(C)c1N(C(=O)Oc1ccc2ccccc2c1)c1ccnc(Nc2cccc(OCCCN3CCN(C)CC3)c2)n1 |
| InChI | InChI=1S/C37H40N6O3/c1-27-9-6-10-28(2)35(27)43(37(44)46-33-16-15-29-11-4-5-12-30(29)25-33)34-17-18-38-36(40-34)39-31-13-7-14-32(26-31)45-24-8-19-42-22-20-41(3)21-23-42/h4-7,9-18,25-26H,8,19-24H2,1-3H3,(H,38,39,40) |
| InChIKey | NGYVRCJEAXGEGO-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.77 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|