C27H27N5O3 — CID 90931368
(2-ethoxyphenyl) N-[2-(3-aminoanilino)pyrimidin-4-yl]-N-(2,6-dimethylphenyl)carbamate (PubChem CID 90931368) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is (2-ethoxyphenyl) N-[2-(3-aminoanilino)pyrimidin-4-yl]-N-(2,6-dimethylphenyl)carbamate.
| Compound Name | (2-ethoxyphenyl) N-[2-(3-aminoanilino)pyrimidin-4-yl]-N-(2,6-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 90931368 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | (2-ethoxyphenyl) N-[2-(3-aminoanilino)pyrimidin-4-yl]-N-(2,6-dimethylphenyl)carbamate |
| SMILES | CCOc1ccccc1OC(=O)N(c1ccnc(Nc2cccc(N)c2)n1)c1c(C)cccc1C |
| InChI | InChI=1S/C27H27N5O3/c1-4-34-22-13-5-6-14-23(22)35-27(33)32(25-18(2)9-7-10-19(25)3)24-15-16-29-26(31-24)30-21-12-8-11-20(28)17-21/h5-17H,4,28H2,1-3H3,(H,29,30,31) |
| InChIKey | MNWITBMSKWYAQB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|