C32H36N6O3 — CID 69062433
(2,6-dimethylphenyl) N-(2-ethoxyphenyl)-N-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate (PubChem CID 69062433) has the molecular formula C32H36N6O3 and a molecular weight of 552.68 g/mol. Its IUPAC name is (2,6-dimethylphenyl) N-(2-ethoxyphenyl)-N-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate.
| Compound Name | (2,6-dimethylphenyl) N-(2-ethoxyphenyl)-N-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 69062433 |
| Molecular Formula | C32H36N6O3 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | (2,6-dimethylphenyl) N-(2-ethoxyphenyl)-N-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate |
| SMILES | CCOc1ccccc1N(C(=O)Oc1c(C)cccc1C)c1ccnc(Nc2ccc(N3CCN(C)CC3)cc2)n1 |
| InChI | InChI=1S/C32H36N6O3/c1-5-40-28-12-7-6-11-27(28)38(32(39)41-30-23(2)9-8-10-24(30)3)29-17-18-33-31(35-29)34-25-13-15-26(16-14-25)37-21-19-36(4)20-22-37/h6-18H,5,19-22H2,1-4H3,(H,33,34,35) |
| InChIKey | IDGMUDUGGDEIAM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|