C35H40ClN5O3 — CID 90835577
(2,4,6-trimethylphenyl) N-[(3-chlorophenyl)methyl]-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate (PubChem CID 90835577) has the molecular formula C35H40ClN5O3 and a molecular weight of 614.19 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) N-[(3-chlorophenyl)methyl]-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate.
| Compound Name | (2,4,6-trimethylphenyl) N-[(3-chlorophenyl)methyl]-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 90835577 |
| Molecular Formula | C35H40ClN5O3 |
| Molecular Weight | 614.19 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | (2,4,6-trimethylphenyl) N-[(3-chlorophenyl)methyl]-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate |
| SMILES | Cc1cc(C)c(OC(=O)N(Cc2cccc(Cl)c2)c2ccnc(Nc3cccc(OCCCN4CCCCC4)c3)n2)c(C)c1 |
| InChI | InChI=1S/C35H40ClN5O3/c1-25-20-26(2)33(27(3)21-25)44-35(42)41(24-28-10-7-11-29(36)22-28)32-14-15-37-34(39-32)38-30-12-8-13-31(23-30)43-19-9-18-40-16-5-4-6-17-40/h7-8,10-15,20-23H,4-6,9,16-19,24H2,1-3H3,(H,37,38,39) |
| InChIKey | NCCPTPALVFFIRA-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.19 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|