C28H34FN5O3 — CID 69063866
(3,5-dimethylphenyl)methyl-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid (PubChem CID 69063866) has the molecular formula C28H34FN5O3 and a molecular weight of 507.61 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid.
| Compound Name | (3,5-dimethylphenyl)methyl-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69063866 |
| Molecular Formula | C28H34FN5O3 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | (3,5-dimethylphenyl)methyl-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamic acid |
| SMILES | Cc1cc(C)cc(CN(C(=O)O)c2ccnc(Nc3ccc(OCCCN4CCCCC4)c(F)c3)n2)c1 |
| InChI | InChI=1S/C28H34FN5O3/c1-20-15-21(2)17-22(16-20)19-34(28(35)36)26-9-10-30-27(32-26)31-23-7-8-25(24(29)18-23)37-14-6-13-33-11-4-3-5-12-33/h7-10,15-18H,3-6,11-14,19H2,1-2H3,(H,35,36)(H,30,31,32) |
| InChIKey | XFFZMSQASGRULY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|