C26H29F3N6O3 — CID 69062625
(3,4-difluorophenyl)methyl-[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamic acid (PubChem CID 69062625) has the molecular formula C26H29F3N6O3 and a molecular weight of 530.55 g/mol. Its IUPAC name is (3,4-difluorophenyl)methyl-[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamic acid.
| Compound Name | (3,4-difluorophenyl)methyl-[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69062625 |
| Molecular Formula | C26H29F3N6O3 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | (3,4-difluorophenyl)methyl-[2-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamic acid |
| SMILES | CN1CCN(CCCOc2ccc(Nc3nccc(N(Cc4ccc(F)c(F)c4)C(=O)O)n3)cc2F)CC1 |
| InChI | InChI=1S/C26H29F3N6O3/c1-33-10-12-34(13-11-33)9-2-14-38-23-6-4-19(16-22(23)29)31-25-30-8-7-24(32-25)35(26(36)37)17-18-3-5-20(27)21(28)15-18/h3-8,15-16H,2,9-14,17H2,1H3,(H,36,37)(H,30,31,32) |
| InChIKey | FUGCGEPELWZCJM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|