C25H29Cl2N7O3 — CID 69070495
(2,5-dichlorophenyl)methyl-[2-[[6-[3-(4-methylpiperazin-1-yl)propoxy]-3-pyridinyl]amino]pyrimidin-4-yl]carbamic acid (PubChem CID 69070495) has the molecular formula C25H29Cl2N7O3 and a molecular weight of 546.46 g/mol. Its IUPAC name is (2,5-dichlorophenyl)methyl-[2-[[6-[3-(4-methylpiperazin-1-yl)propoxy]-3-pyridinyl]amino]pyrimidin-4-yl]carbamic acid.
| Compound Name | (2,5-dichlorophenyl)methyl-[2-[[6-[3-(4-methylpiperazin-1-yl)propoxy]-3-pyridinyl]amino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69070495 |
| Molecular Formula | C25H29Cl2N7O3 |
| Molecular Weight | 546.46 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | (2,5-dichlorophenyl)methyl-[2-[[6-[3-(4-methylpiperazin-1-yl)propoxy]-3-pyridinyl]amino]pyrimidin-4-yl]carbamic acid |
| SMILES | CN1CCN(CCCOc2ccc(Nc3nccc(N(Cc4cc(Cl)ccc4Cl)C(=O)O)n3)cn2)CC1 |
| InChI | InChI=1S/C25H29Cl2N7O3/c1-32-10-12-33(13-11-32)9-2-14-37-23-6-4-20(16-29-23)30-24-28-8-7-22(31-24)34(25(35)36)17-18-15-19(26)3-5-21(18)27/h3-8,15-16H,2,9-14,17H2,1H3,(H,35,36)(H,28,30,31) |
| InChIKey | XJYRNMSOQKTENY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|