C24H24ClF3N6O2 — CID 69069993
[2-chloro-5-(trifluoromethyl)phenyl]methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamic acid (PubChem CID 69069993) has the molecular formula C24H24ClF3N6O2 and a molecular weight of 520.94 g/mol. Its IUPAC name is [2-chloro-5-(trifluoromethyl)phenyl]methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamic acid.
| Compound Name | [2-chloro-5-(trifluoromethyl)phenyl]methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69069993 |
| Molecular Formula | C24H24ClF3N6O2 |
| Molecular Weight | 520.94 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | [2-chloro-5-(trifluoromethyl)phenyl]methyl-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamic acid |
| SMILES | CN1CCN(c2ccc(Nc3nccc(N(Cc4cc(C(F)(F)F)ccc4Cl)C(=O)O)n3)cc2)CC1 |
| InChI | InChI=1S/C24H24ClF3N6O2/c1-32-10-12-33(13-11-32)19-5-3-18(4-6-19)30-22-29-9-8-21(31-22)34(23(35)36)15-16-14-17(24(26,27)28)2-7-20(16)25/h2-9,14H,10-13,15H2,1H3,(H,35,36)(H,29,30,31) |
| InChIKey | SJSSHUNAWUCJBM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.94 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|