C27H34N6O4 — CID 69068245
(2,5-dimethoxyphenyl)methyl-[2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamic acid (PubChem CID 69068245) has the molecular formula C27H34N6O4 and a molecular weight of 506.61 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl-[2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamic acid.
| Compound Name | (2,5-dimethoxyphenyl)methyl-[2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69068245 |
| Molecular Formula | C27H34N6O4 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl-[2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamic acid |
| SMILES | COc1ccc(OC)c(CN(C(=O)O)c2ccnc(Nc3ccc(N4CCN(C(C)C)CC4)cc3)n2)c1 |
| InChI | InChI=1S/C27H34N6O4/c1-19(2)31-13-15-32(16-14-31)22-7-5-21(6-8-22)29-26-28-12-11-25(30-26)33(27(34)35)18-20-17-23(36-3)9-10-24(20)37-4/h5-12,17,19H,13-16,18H2,1-4H3,(H,34,35)(H,28,29,30) |
| InChIKey | WOLZPRTYTAFTLY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|