C29H37FN6O5 — CID 69066681
(2,5-dimethoxyphenyl)methyl-[2-[4-[6-(dimethylamino)hexylcarbamoyl]-3-fluoroanilino]pyrimidin-4-yl]carbamic acid (PubChem CID 69066681) has the molecular formula C29H37FN6O5 and a molecular weight of 568.65 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl-[2-[4-[6-(dimethylamino)hexylcarbamoyl]-3-fluoroanilino]pyrimidin-4-yl]carbamic acid.
| Compound Name | (2,5-dimethoxyphenyl)methyl-[2-[4-[6-(dimethylamino)hexylcarbamoyl]-3-fluoroanilino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69066681 |
| Molecular Formula | C29H37FN6O5 |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl-[2-[4-[6-(dimethylamino)hexylcarbamoyl]-3-fluoroanilino]pyrimidin-4-yl]carbamic acid |
| SMILES | COc1ccc(OC)c(CN(C(=O)O)c2ccnc(Nc3ccc(C(=O)NCCCCCCN(C)C)c(F)c3)n2)c1 |
| InChI | InChI=1S/C29H37FN6O5/c1-35(2)16-8-6-5-7-14-31-27(37)23-11-9-21(18-24(23)30)33-28-32-15-13-26(34-28)36(29(38)39)19-20-17-22(40-3)10-12-25(20)41-4/h9-13,15,17-18H,5-8,14,16,19H2,1-4H3,(H,31,37)(H,38,39)(H,32,33,34) |
| InChIKey | FVWQDNLDORGPSA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|