C35H41N5O5S — CID 91080269
(2-methylsulfanylphenyl) N-[(2,5-dimethoxyphenyl)methyl]-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate (PubChem CID 91080269) has the molecular formula C35H41N5O5S and a molecular weight of 643.81 g/mol. Its IUPAC name is (2-methylsulfanylphenyl) N-[(2,5-dimethoxyphenyl)methyl]-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate.
| Compound Name | (2-methylsulfanylphenyl) N-[(2,5-dimethoxyphenyl)methyl]-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 91080269 |
| Molecular Formula | C35H41N5O5S |
| Molecular Weight | 643.81 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | (2-methylsulfanylphenyl) N-[(2,5-dimethoxyphenyl)methyl]-N-[2-[3-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate |
| SMILES | COc1ccc(OC)c(CN(C(=O)Oc2ccccc2SC)c2ccnc(Nc3cccc(OCCCN4CCCCC4)c3)n2)c1 |
| InChI | InChI=1S/C35H41N5O5S/c1-42-28-15-16-30(43-2)26(23-28)25-40(35(41)45-31-13-5-6-14-32(31)46-3)33-17-18-36-34(38-33)37-27-11-9-12-29(24-27)44-22-10-21-39-19-7-4-8-20-39/h5-6,9,11-18,23-24H,4,7-8,10,19-22,25H2,1-3H3,(H,36,37,38) |
| InChIKey | CTPUPNYAQCKMKJ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.81 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|