C35H40FN5O6 — CID 69066685
[2-(methoxymethyl)phenyl] N-(2,4-dimethoxyphenyl)-N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate (PubChem CID 69066685) has the molecular formula C35H40FN5O6 and a molecular weight of 645.73 g/mol. Its IUPAC name is [2-(methoxymethyl)phenyl] N-(2,4-dimethoxyphenyl)-N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate.
| Compound Name | [2-(methoxymethyl)phenyl] N-(2,4-dimethoxyphenyl)-N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 69066685 |
| Molecular Formula | C35H40FN5O6 |
| Molecular Weight | 645.73 g/mol |
| Exact Mass | 645.30 |
| IUPAC Name | [2-(methoxymethyl)phenyl] N-(2,4-dimethoxyphenyl)-N-[2-[3-fluoro-4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl]carbamate |
| SMILES | COCc1ccccc1OC(=O)N(c1ccnc(Nc2ccc(OCCCN3CCCCC3)c(F)c2)n1)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C35H40FN5O6/c1-43-24-25-10-5-6-11-30(25)47-35(42)41(29-14-13-27(44-2)23-32(29)45-3)33-16-17-37-34(39-33)38-26-12-15-31(28(36)22-26)46-21-9-20-40-18-7-4-8-19-40/h5-6,10-17,22-23H,4,7-9,18-21,24H2,1-3H3,(H,37,38,39) |
| InChIKey | DVBGPOOALBIOFR-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 107.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.73 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|