C29H38N6O5 — CID 69065619
(2,5-dimethoxyphenyl)methyl-[2-[3-[6-(dimethylamino)hexylcarbamoyl]anilino]pyrimidin-4-yl]carbamic acid (PubChem CID 69065619) has the molecular formula C29H38N6O5 and a molecular weight of 550.66 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl-[2-[3-[6-(dimethylamino)hexylcarbamoyl]anilino]pyrimidin-4-yl]carbamic acid.
| Compound Name | (2,5-dimethoxyphenyl)methyl-[2-[3-[6-(dimethylamino)hexylcarbamoyl]anilino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69065619 |
| Molecular Formula | C29H38N6O5 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl-[2-[3-[6-(dimethylamino)hexylcarbamoyl]anilino]pyrimidin-4-yl]carbamic acid |
| SMILES | COc1ccc(OC)c(CN(C(=O)O)c2ccnc(Nc3cccc(C(=O)NCCCCCCN(C)C)c3)n2)c1 |
| InChI | InChI=1S/C29H38N6O5/c1-34(2)17-8-6-5-7-15-30-27(36)21-10-9-11-23(18-21)32-28-31-16-14-26(33-28)35(29(37)38)20-22-19-24(39-3)12-13-25(22)40-4/h9-14,16,18-19H,5-8,15,17,20H2,1-4H3,(H,30,36)(H,37,38)(H,31,32,33) |
| InChIKey | MBRPPBYNATUKHE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|